C12H16N4O4S — CID 62850382
8-(1-methylpyrrol-3-yl)sulfonyl-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 62850382) has the molecular formula C12H16N4O4S and a molecular weight of 312.35 g/mol. Its IUPAC name is 8-(1-methylpyrrol-3-yl)sulfonyl-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-(1-methylpyrrol-3-yl)sulfonyl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 62850382 |
| Molecular Formula | C12H16N4O4S |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 8-(1-methylpyrrol-3-yl)sulfonyl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | Cn1ccc(S(=O)(=O)N2CCC3(CC2)NC(=O)NC3=O)c1 |
| InChI | InChI=1S/C12H16N4O4S/c1-15-5-2-9(8-15)21(19,20)16-6-3-12(4-7-16)10(17)13-11(18)14-12/h2,5,8H,3-4,6-7H2,1H3,(H2,13,14,17,18) |
| InChIKey | BHECWPKUOBEGNZ-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 100.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|