C21H18F4N2O3S — CID 6286222
N-[(Z)-[4-methoxy-3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]methylideneamino]-1-benzothiophene-3-carboxamide (PubChem CID 6286222) has the molecular formula C21H18F4N2O3S and a molecular weight of 454.45 g/mol. Its IUPAC name is N-[(Z)-[4-methoxy-3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]methylideneamino]-1-benzothiophene-3-carboxamide.
| Compound Name | N-[(Z)-[4-methoxy-3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]methylideneamino]-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 6286222 |
| Molecular Formula | C21H18F4N2O3S |
| Molecular Weight | 454.45 g/mol |
| Exact Mass | 454.10 |
| IUPAC Name | N-[(Z)-[4-methoxy-3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]methylideneamino]-1-benzothiophene-3-carboxamide |
| SMILES | COc1ccc(/C=N\NC(=O)c2csc3ccccc23)cc1COCC(F)(F)C(F)F |
| InChI | InChI=1S/C21H18F4N2O3S/c1-29-17-7-6-13(8-14(17)10-30-12-21(24,25)20(22)23)9-26-27-19(28)16-11-31-18-5-3-2-4-15(16)18/h2-9,11,20H,10,12H2,1H3,(H,27,28)/b26-9- |
| InChIKey | YAFCHBGFJNVFNR-WMDMUMDLSA-N |
| XLogP | 5.09 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.45 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|