C27H31BrN4O4 — CID 6294036
[(E)-[7-(bromomethyl)-1,7-dimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 12,15,15-trimethyl-6-nitro-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4(9),5,7,10-pentaene-1-carboxylate (PubChem CID 6294036) has the molecular formula C27H31BrN4O4 and a molecular weight of 555.47 g/mol. Its IUPAC name is [(E)-[7-(bromomethyl)-1,7-dimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 12,15,15-trimethyl-6-nitro-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4(9),5,7,10-pentaene-1-carboxylate.
| Compound Name | [(E)-[7-(bromomethyl)-1,7-dimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 12,15,15-trimethyl-6-nitro-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4(9),5,7,10-pentaene-1-carboxylate |
|---|---|
| PubChem CID | 6294036 |
| Molecular Formula | C27H31BrN4O4 |
| Molecular Weight | 555.47 g/mol |
| Exact Mass | 554.15 |
| IUPAC Name | [(E)-[7-(bromomethyl)-1,7-dimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 12,15,15-trimethyl-6-nitro-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4(9),5,7,10-pentaene-1-carboxylate |
| SMILES | CC12CCC(C/C1=N\OC(=O)C13CCC(C)(c4nc5ccc([N+](=O)[O-])cc5nc41)C3(C)C)C2(C)CBr |
| InChI | InChI=1S/C27H31BrN4O4/c1-23(2)25(4)10-11-27(23,21-20(25)29-17-7-6-16(32(34)35)13-18(17)30-21)22(33)36-31-19-12-15-8-9-24(19,3)26(15,5)14-28/h6-7,13,15H,8-12,14H2,1-5H3/b31-19+ |
| InChIKey | SWBXQXOTBMQFKB-ZCTHSVRISA-N |
| XLogP | 5.99 |
| TPSA | 107.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.47 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|