C17H18N6O6PS+ — CID 6335125
[(2S,5R)-5-[2-amino-6-[(4-nitrophenyl)methylsulfanyl]purin-9-yl]oxolan-2-yl]methoxy-hydroxy-oxophosphanium (PubChem CID 6335125) has the molecular formula C17H18N6O6PS+ and a molecular weight of 465.41 g/mol. Its IUPAC name is [(2S,5R)-5-[2-amino-6-[(4-nitrophenyl)methylsulfanyl]purin-9-yl]oxolan-2-yl]methoxy-hydroxy-oxophosphanium.
| Compound Name | [(2S,5R)-5-[2-amino-6-[(4-nitrophenyl)methylsulfanyl]purin-9-yl]oxolan-2-yl]methoxy-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 6335125 |
| Molecular Formula | C17H18N6O6PS+ |
| Molecular Weight | 465.41 g/mol |
| Exact Mass | 465.07 |
| IUPAC Name | [(2S,5R)-5-[2-amino-6-[(4-nitrophenyl)methylsulfanyl]purin-9-yl]oxolan-2-yl]methoxy-hydroxy-oxophosphanium |
| SMILES | Nc1nc(SCc2ccc([N+](=O)[O-])cc2)c2ncn([C@H]3CC[C@@H](CO[P+](=O)O)O3)c2n1 |
| InChI | InChI=1S/C17H17N6O6PS/c18-17-20-15-14(16(21-17)31-8-10-1-3-11(4-2-10)23(24)25)19-9-22(15)13-6-5-12(29-13)7-28-30(26)27/h1-4,9,12-13H,5-8H2,(H2-,18,20,21,26,27)/p+1/t12-,13+/m0/s1 |
| InChIKey | RCMUXUFVXDGKJQ-QWHCGFSZSA-O |
| XLogP | 2.95 |
| TPSA | 168.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.41 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|