C14H19N5O — CID 63351656
[2-(3,5-dimethyl-1,2-oxazol-4-yl)-6,7,8,9-tetrahydro-5H-cyclohepta[d]pyrimidin-4-yl]hydrazine (PubChem CID 63351656) has the molecular formula C14H19N5O and a molecular weight of 273.34 g/mol. Its IUPAC name is [2-(3,5-dimethyl-1,2-oxazol-4-yl)-6,7,8,9-tetrahydro-5H-cyclohepta[d]pyrimidin-4-yl]hydrazine.
| Compound Name | [2-(3,5-dimethyl-1,2-oxazol-4-yl)-6,7,8,9-tetrahydro-5H-cyclohepta[d]pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 63351656 |
| Molecular Formula | C14H19N5O |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | [2-(3,5-dimethyl-1,2-oxazol-4-yl)-6,7,8,9-tetrahydro-5H-cyclohepta[d]pyrimidin-4-yl]hydrazine |
| SMILES | Cc1noc(C)c1-c1nc2c(c(NN)n1)CCCCC2 |
| InChI | InChI=1S/C14H19N5O/c1-8-12(9(2)20-19-8)14-16-11-7-5-3-4-6-10(11)13(17-14)18-15/h3-7,15H2,1-2H3,(H,16,17,18) |
| InChIKey | UHSKOMDUMPEOMO-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 89.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|