C13H21N2+ — CID 6340999
[(2R)-1-amino-2-[4-(2-methylpropyl)phenyl]propylidene]azanium (PubChem CID 6340999) has the molecular formula C13H21N2+ and a molecular weight of 205.32 g/mol. Its IUPAC name is [(2R)-1-amino-2-[4-(2-methylpropyl)phenyl]propylidene]azanium.
| Compound Name | [(2R)-1-amino-2-[4-(2-methylpropyl)phenyl]propylidene]azanium |
|---|---|
| PubChem CID | 6340999 |
| Molecular Formula | C13H21N2+ |
| Molecular Weight | 205.32 g/mol |
| Exact Mass | 205.17 |
| IUPAC Name | [(2R)-1-amino-2-[4-(2-methylpropyl)phenyl]propylidene]azanium |
| SMILES | CC(C)Cc1ccc([C@@H](C)C(N)=[NH2+])cc1 |
| InChI | InChI=1S/C13H20N2/c1-9(2)8-11-4-6-12(7-5-11)10(3)13(14)15/h4-7,9-10H,8H2,1-3H3,(H3,14,15)/p+1/t10-/m1/s1 |
| InChIKey | BRAQQUBPTZFZLG-SNVBAGLBSA-O |
| XLogP | 1.10 |
| TPSA | 51.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.32 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|