About (2S)-N'-methyl-2-[4-(2-methylpropyl)phenyl]propanimidamide;hydrochloride
(2S)-N'-methyl-2-[4-(2-methylpropyl)phenyl]propanimidamide;hydrochloride (PubChem CID 67369642) has the molecular formula C14H23ClN2
and a molecular weight of 254.80 g/mol. Its IUPAC name is (2S)-N'-methyl-2-[4-(2-methylpropyl)phenyl]propanimidamide;hydrochloride.
Molecular Properties
| Compound Name | (2S)-N'-methyl-2-[4-(2-methylpropyl)phenyl]propanimidamide;hydrochloride |
| PubChem CID | 67369642 |
| Molecular Formula | C14H23ClN2 |
| Molecular Weight | 254.80 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | (2S)-N'-methyl-2-[4-(2-methylpropyl)phenyl]propanimidamide;hydrochloride |
| SMILES | C/N=C(\N)[C@@H](C)c1ccc(CC(C)C)cc1.Cl |
| InChI | InChI=1S/C14H22N2.ClH/c1-10(2)9-12-5-7-13(8-6-12)11(3)14(15)16-4;/h5-8,10-11H,9H2,1-4H3,(H2,15,16);1H/t11-;/m0./s1 |
| InChIKey | OCNCZEBLPBAHSG-MERQFXBCSA-N |
| XLogP | 3.40 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.80 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (2S)-N'-methyl-2-[4-(2-methylpropyl)phenyl]propanimidamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-N'-methyl-2-[4-(2-methylpropyl)phenyl]propanimidamide;hydrochloride?
The IUPAC name of (2S)-N'-methyl-2-[4-(2-methylpropyl)phenyl]propanimidamide;hydrochloride (CID 67369642) is (2S)-N'-methyl-2-[4-(2-methylpropyl)phenyl]propanimidamide;hydrochloride.
What is the SMILES notation for (2S)-N'-methyl-2-[4-(2-methylpropyl)phenyl]propanimidamide;hydrochloride?
The canonical SMILES for (2S)-N'-methyl-2-[4-(2-methylpropyl)phenyl]propanimidamide;hydrochloride is C/N=C(\N)[C@@H](C)c1ccc(CC(C)C)cc1.Cl.
What is the InChIKey of (2S)-N'-methyl-2-[4-(2-methylpropyl)phenyl]propanimidamide;hydrochloride?
The InChIKey is OCNCZEBLPBAHSG-MERQFXBCSA-N. The full InChI is InChI=1S/C14H22N2.ClH/c1-10(2)9-12-5-7-13(8-6-12)11(3)14(15)16-4;/h5-8,10-11H,9H2,1-4H3,(H2,15,16);1H/t11-;/m0./s1.
What are the key properties of (2S)-N'-methyl-2-[4-(2-methylpropyl)phenyl]propanimidamide;hydrochloride?
(2S)-N'-methyl-2-[4-(2-methylpropyl)phenyl]propanimidamide;hydrochloride has a molecular weight of 254.80 g/mol, XLogP of 3.40, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-N'-methyl-2-[4-(2-methylpropyl)phenyl]propanimidamide;hydrochloride is sourced from PubChem (CID 67369642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).