C20H35N3 — CID 92833235
(2R)-N'-[3-(diethylamino)propyl]-2-[4-(2-methylpropyl)phenyl]propanimidamide (PubChem CID 92833235) has the molecular formula C20H35N3 and a molecular weight of 317.52 g/mol. Its IUPAC name is (2R)-N'-[3-(diethylamino)propyl]-2-[4-(2-methylpropyl)phenyl]propanimidamide.
| Compound Name | (2R)-N'-[3-(diethylamino)propyl]-2-[4-(2-methylpropyl)phenyl]propanimidamide |
|---|---|
| PubChem CID | 92833235 |
| Molecular Formula | C20H35N3 |
| Molecular Weight | 317.52 g/mol |
| Exact Mass | 317.28 |
| IUPAC Name | (2R)-N'-[3-(diethylamino)propyl]-2-[4-(2-methylpropyl)phenyl]propanimidamide |
| SMILES | CCN(CC)CCC/N=C(\N)[C@H](C)c1ccc(CC(C)C)cc1 |
| InChI | InChI=1S/C20H35N3/c1-6-23(7-2)14-8-13-22-20(21)17(5)19-11-9-18(10-12-19)15-16(3)4/h9-12,16-17H,6-8,13-15H2,1-5H3,(H2,21,22)/t17-/m1/s1 |
| InChIKey | PGOMMNOHXDTPOT-QGZVFWFLSA-N |
| XLogP | 4.08 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.52 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|