C13H20N2O — CID 173066411
(2R)-N'-hydroxy-2-[4-(2-methylpropyl)phenyl]propanimidamide (PubChem CID 173066411) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is (2R)-N'-hydroxy-2-[4-(2-methylpropyl)phenyl]propanimidamide.
| Compound Name | (2R)-N'-hydroxy-2-[4-(2-methylpropyl)phenyl]propanimidamide |
|---|---|
| PubChem CID | 173066411 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | (2R)-N'-hydroxy-2-[4-(2-methylpropyl)phenyl]propanimidamide |
| SMILES | CC(C)Cc1ccc([C@@H](C)C(N)=NO)cc1 |
| InChI | InChI=1S/C13H20N2O/c1-9(2)8-11-4-6-12(7-5-11)10(3)13(14)15-16/h4-7,9-10,16H,8H2,1-3H3,(H2,14,15)/t10-/m1/s1 |
| InChIKey | GPHQCZSAEHQGBB-SNVBAGLBSA-N |
| XLogP | 2.73 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|