C13H16Cl2FN — CID 63477411
N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-2,2-dimethylcyclopropan-1-amine (PubChem CID 63477411) has the molecular formula C13H16Cl2FN and a molecular weight of 276.18 g/mol. Its IUPAC name is N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-2,2-dimethylcyclopropan-1-amine.
| Compound Name | N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-2,2-dimethylcyclopropan-1-amine |
|---|---|
| PubChem CID | 63477411 |
| Molecular Formula | C13H16Cl2FN |
| Molecular Weight | 276.18 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-2,2-dimethylcyclopropan-1-amine |
| SMILES | CC(NC1CC1(C)C)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C13H16Cl2FN/c1-7(17-12-6-13(12,2)3)8-4-11(16)10(15)5-9(8)14/h4-5,7,12,17H,6H2,1-3H3 |
| InChIKey | YJCRPLZYSPBAQX-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.18 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|