C9H12BF3N- — CID 63704115
(N,2-dimethylanilino)methyl-trifluoroboranuide (PubChem CID 63704115) has the molecular formula C9H12BF3N- and a molecular weight of 202.01 g/mol. Its IUPAC name is (N,2-dimethylanilino)methyl-trifluoroboranuide.
| Compound Name | (N,2-dimethylanilino)methyl-trifluoroboranuide |
|---|---|
| PubChem CID | 63704115 |
| Molecular Formula | C9H12BF3N- |
| Molecular Weight | 202.01 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | (N,2-dimethylanilino)methyl-trifluoroboranuide |
| SMILES | Cc1ccccc1N(C)C[B-](F)(F)F |
| InChI | InChI=1S/C9H12BF3N/c1-8-5-3-4-6-9(8)14(2)7-10(11,12)13/h3-6H,7H2,1-2H3/q-1 |
| InChIKey | FLXKGJYUXNYTFQ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.01 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|