C15H18F2N2S — CID 63734265
2-(difluoromethyl)-1-N-(1-thiophen-2-ylbutyl)benzene-1,4-diamine (PubChem CID 63734265) has the molecular formula C15H18F2N2S and a molecular weight of 296.39 g/mol. Its IUPAC name is 2-(difluoromethyl)-1-N-(1-thiophen-2-ylbutyl)benzene-1,4-diamine.
| Compound Name | 2-(difluoromethyl)-1-N-(1-thiophen-2-ylbutyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 63734265 |
| Molecular Formula | C15H18F2N2S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 2-(difluoromethyl)-1-N-(1-thiophen-2-ylbutyl)benzene-1,4-diamine |
| SMILES | CCCC(Nc1ccc(N)cc1C(F)F)c1cccs1 |
| InChI | InChI=1S/C15H18F2N2S/c1-2-4-13(14-5-3-8-20-14)19-12-7-6-10(18)9-11(12)15(16)17/h3,5-9,13,15,19H,2,4,18H2,1H3 |
| InChIKey | YWVNZYHTFWKQJL-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|