C10H9N5O2S2 — CID 6375412
ethyl (Z)-2-cyano-3-[[5-(cyanomethylsulfanyl)-1,3,4-thiadiazol-2-yl]amino]prop-2-enoate (PubChem CID 6375412) has the molecular formula C10H9N5O2S2 and a molecular weight of 295.35 g/mol. Its IUPAC name is ethyl (Z)-2-cyano-3-[[5-(cyanomethylsulfanyl)-1,3,4-thiadiazol-2-yl]amino]prop-2-enoate.
| Compound Name | ethyl (Z)-2-cyano-3-[[5-(cyanomethylsulfanyl)-1,3,4-thiadiazol-2-yl]amino]prop-2-enoate |
|---|---|
| PubChem CID | 6375412 |
| Molecular Formula | C10H9N5O2S2 |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.02 |
| IUPAC Name | ethyl (Z)-2-cyano-3-[[5-(cyanomethylsulfanyl)-1,3,4-thiadiazol-2-yl]amino]prop-2-enoate |
| SMILES | CCOC(=O)/C(C#N)=C\Nc1nnc(SCC#N)s1 |
| InChI | InChI=1S/C10H9N5O2S2/c1-2-17-8(16)7(5-12)6-13-9-14-15-10(19-9)18-4-3-11/h6H,2,4H2,1H3,(H,13,14)/b7-6- |
| InChIKey | XLYBWEXVVOZTSW-SREVYHEPSA-N |
| XLogP | 1.54 |
| TPSA | 111.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|