C10H15NO3 — CID 63778866
4-cyclohexylmorpholine-2,6-dione (PubChem CID 63778866) has the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. Its IUPAC name is 4-cyclohexylmorpholine-2,6-dione.
| Compound Name | 4-cyclohexylmorpholine-2,6-dione |
|---|---|
| PubChem CID | 63778866 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | 4-cyclohexylmorpholine-2,6-dione |
| SMILES | O=C1CN(C2CCCCC2)CC(=O)O1 |
| InChI | InChI=1S/C10H15NO3/c12-9-6-11(7-10(13)14-9)8-4-2-1-3-5-8/h8H,1-7H2 |
| InChIKey | GOYHPGRMKZWITI-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|