C12H16F2N2O2S — CID 63910406
1-(3,4-difluorophenyl)sulfonyl-2,6-dimethylpiperazine (PubChem CID 63910406) has the molecular formula C12H16F2N2O2S and a molecular weight of 290.34 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)sulfonyl-2,6-dimethylpiperazine.
| Compound Name | 1-(3,4-difluorophenyl)sulfonyl-2,6-dimethylpiperazine |
|---|---|
| PubChem CID | 63910406 |
| Molecular Formula | C12H16F2N2O2S |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 1-(3,4-difluorophenyl)sulfonyl-2,6-dimethylpiperazine |
| SMILES | CC1CNCC(C)N1S(=O)(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C12H16F2N2O2S/c1-8-6-15-7-9(2)16(8)19(17,18)10-3-4-11(13)12(14)5-10/h3-5,8-9,15H,6-7H2,1-2H3 |
| InChIKey | GBLUEQMKFSZFDA-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |