C13H20N2O2S — CID 63922605
1-(1,1-dioxothian-3-yl)-4,5,6,7-tetrahydroindol-4-amine (PubChem CID 63922605) has the molecular formula C13H20N2O2S and a molecular weight of 268.38 g/mol. Its IUPAC name is 1-(1,1-dioxothian-3-yl)-4,5,6,7-tetrahydroindol-4-amine.
| Compound Name | 1-(1,1-dioxothian-3-yl)-4,5,6,7-tetrahydroindol-4-amine |
|---|---|
| PubChem CID | 63922605 |
| Molecular Formula | C13H20N2O2S |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 1-(1,1-dioxothian-3-yl)-4,5,6,7-tetrahydroindol-4-amine |
| SMILES | NC1CCCc2c1ccn2C1CCCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H20N2O2S/c14-12-4-1-5-13-11(12)6-7-15(13)10-3-2-8-18(16,17)9-10/h6-7,10,12H,1-5,8-9,14H2 |
| InChIKey | BUSSRHQZXMABGF-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 65.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |