About 4-methyl-2-thiatricyclo[3.3.1.13,7]decane
4-methyl-2-thiatricyclo[3.3.1.13,7]decane (PubChem CID 6427691) has the molecular formula C10H16S
and a molecular weight of 168.30 g/mol. Its IUPAC name is 4-methyl-2-thiatricyclo[3.3.1.13,7]decane.
Molecular Properties
| Compound Name | 4-methyl-2-thiatricyclo[3.3.1.13,7]decane |
| PubChem CID | 6427691 |
| Molecular Formula | C10H16S |
| Molecular Weight | 168.30 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | 4-methyl-2-thiatricyclo[3.3.1.13,7]decane |
| SMILES | CC1C2CC3CC(C2)SC1C3 |
| InChI | InChI=1S/C10H16S/c1-6-8-2-7-3-9(5-8)11-10(6)4-7/h6-10H,2-5H2,1H3 |
| InChIKey | ZBBUECPKKSCLQX-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.30 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-methyl-2-thiatricyclo[3.3.1.13,7]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2-thiatricyclo[3.3.1.13,7]decane?
The IUPAC name of 4-methyl-2-thiatricyclo[3.3.1.13,7]decane (CID 6427691) is 4-methyl-2-thiatricyclo[3.3.1.13,7]decane.
What is the SMILES notation for 4-methyl-2-thiatricyclo[3.3.1.13,7]decane?
The canonical SMILES for 4-methyl-2-thiatricyclo[3.3.1.13,7]decane is CC1C2CC3CC(C2)SC1C3.
What is the InChIKey of 4-methyl-2-thiatricyclo[3.3.1.13,7]decane?
The InChIKey is ZBBUECPKKSCLQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16S/c1-6-8-2-7-3-9(5-8)11-10(6)4-7/h6-10H,2-5H2,1H3.
What are the key properties of 4-methyl-2-thiatricyclo[3.3.1.13,7]decane?
4-methyl-2-thiatricyclo[3.3.1.13,7]decane has a molecular weight of 168.30 g/mol, XLogP of 2.93, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2-thiatricyclo[3.3.1.13,7]decane is sourced from PubChem (CID 6427691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).