C17H30S — CID 6428489
4,8-dibutyl-2-thiatricyclo[3.3.1.13,7]decane (PubChem CID 6428489) has the molecular formula C17H30S and a molecular weight of 266.49 g/mol. Its IUPAC name is 4,8-dibutyl-2-thiatricyclo[3.3.1.13,7]decane.
| Compound Name | 4,8-dibutyl-2-thiatricyclo[3.3.1.13,7]decane |
|---|---|
| PubChem CID | 6428489 |
| Molecular Formula | C17H30S |
| Molecular Weight | 266.49 g/mol |
| Exact Mass | 266.21 |
| IUPAC Name | 4,8-dibutyl-2-thiatricyclo[3.3.1.13,7]decane |
| SMILES | CCCCC1C2CC3CC1SC(C2)C3CCCC |
| InChI | InChI=1S/C17H30S/c1-3-5-7-14-12-9-13-11-16(14)18-17(10-12)15(13)8-6-4-2/h12-17H,3-11H2,1-2H3 |
| InChIKey | URKLLDGPLCCAFG-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.49 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |