C13H22S — CID 6428491
4,8-diethyl-2-thiatricyclo[3.3.1.13,7]decane (PubChem CID 6428491) has the molecular formula C13H22S and a molecular weight of 210.39 g/mol. Its IUPAC name is 4,8-diethyl-2-thiatricyclo[3.3.1.13,7]decane.
| Compound Name | 4,8-diethyl-2-thiatricyclo[3.3.1.13,7]decane |
|---|---|
| PubChem CID | 6428491 |
| Molecular Formula | C13H22S |
| Molecular Weight | 210.39 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 4,8-diethyl-2-thiatricyclo[3.3.1.13,7]decane |
| SMILES | CCC1C2CC3CC1SC(C2)C3CC |
| InChI | InChI=1S/C13H22S/c1-3-10-8-5-9-7-12(10)14-13(6-8)11(9)4-2/h8-13H,3-7H2,1-2H3 |
| InChIKey | HMDMYPGLMLNKOS-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.39 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |