C15H26S — CID 6428494
4,8-dipropyl-2-thiatricyclo[3.3.1.13,7]decane (PubChem CID 6428494) has the molecular formula C15H26S and a molecular weight of 238.44 g/mol. Its IUPAC name is 4,8-dipropyl-2-thiatricyclo[3.3.1.13,7]decane.
| Compound Name | 4,8-dipropyl-2-thiatricyclo[3.3.1.13,7]decane |
|---|---|
| PubChem CID | 6428494 |
| Molecular Formula | C15H26S |
| Molecular Weight | 238.44 g/mol |
| Exact Mass | 238.18 |
| IUPAC Name | 4,8-dipropyl-2-thiatricyclo[3.3.1.13,7]decane |
| SMILES | CCCC1C2CC3CC1SC(C2)C3CCC |
| InChI | InChI=1S/C15H26S/c1-3-5-12-10-7-11-9-14(12)16-15(8-10)13(11)6-4-2/h10-15H,3-9H2,1-2H3 |
| InChIKey | ZJMZEHFJOGVBHY-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.44 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |