C11H18S — CID 6428493
4,8-dimethyl-2-thiatricyclo[3.3.1.13,7]decane (PubChem CID 6428493) has the molecular formula C11H18S and a molecular weight of 182.33 g/mol. Its IUPAC name is 4,8-dimethyl-2-thiatricyclo[3.3.1.13,7]decane.
| Compound Name | 4,8-dimethyl-2-thiatricyclo[3.3.1.13,7]decane |
|---|---|
| PubChem CID | 6428493 |
| Molecular Formula | C11H18S |
| Molecular Weight | 182.33 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 4,8-dimethyl-2-thiatricyclo[3.3.1.13,7]decane |
| SMILES | CC1C2CC3CC1SC(C2)C3C |
| InChI | InChI=1S/C11H18S/c1-6-8-3-9-5-10(6)12-11(4-8)7(9)2/h6-11H,3-5H2,1-2H3 |
| InChIKey | LOTVPGBDKCHZJQ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.33 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |