C28H49NO4Si3 — CID 6430582
[tert-butyl(dimethyl)silyl] 4,8-bis[[tert-butyl(dimethyl)silyl]oxy]quinoline-2-carboxylate (PubChem CID 6430582) has the molecular formula C28H49NO4Si3 and a molecular weight of 547.96 g/mol. Its IUPAC name is [tert-butyl(dimethyl)silyl] 4,8-bis[[tert-butyl(dimethyl)silyl]oxy]quinoline-2-carboxylate.
| Compound Name | [tert-butyl(dimethyl)silyl] 4,8-bis[[tert-butyl(dimethyl)silyl]oxy]quinoline-2-carboxylate |
|---|---|
| PubChem CID | 6430582 |
| Molecular Formula | C28H49NO4Si3 |
| Molecular Weight | 547.96 g/mol |
| Exact Mass | 547.30 |
| IUPAC Name | [tert-butyl(dimethyl)silyl] 4,8-bis[[tert-butyl(dimethyl)silyl]oxy]quinoline-2-carboxylate |
| SMILES | CC(C)(C)[Si](C)(C)OC(=O)c1cc(O[Si](C)(C)C(C)(C)C)c2cccc(O[Si](C)(C)C(C)(C)C)c2n1 |
| InChI | InChI=1S/C28H49NO4Si3/c1-26(2,3)34(10,11)31-22-18-16-17-20-23(32-35(12,13)27(4,5)6)19-21(29-24(20)22)25(30)33-36(14,15)28(7,8)9/h16-19H,1-15H3 |
| InChIKey | IRJIRIHKMGRQPY-UHFFFAOYSA-N |
| XLogP | 9.16 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.96 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|