C19H28ClNO2 — CID 6444854
methyl 2-[1-[(E)-3-methyl-4-phenylbut-2-enyl]piperidin-1-ium-1-yl]acetate chloride (PubChem CID 6444854) has the molecular formula C19H28ClNO2 and a molecular weight of 337.89 g/mol. Its IUPAC name is methyl 2-[1-[(E)-3-methyl-4-phenylbut-2-enyl]piperidin-1-ium-1-yl]acetate chloride.
| Compound Name | methyl 2-[1-[(E)-3-methyl-4-phenylbut-2-enyl]piperidin-1-ium-1-yl]acetate chloride |
|---|---|
| PubChem CID | 6444854 |
| Molecular Formula | C19H28ClNO2 |
| Molecular Weight | 337.89 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | methyl 2-[1-[(E)-3-methyl-4-phenylbut-2-enyl]piperidin-1-ium-1-yl]acetate chloride |
| SMILES | COC(=O)C[N+]1(C/C=C(\C)Cc2ccccc2)CCCCC1.[Cl-] |
| InChI | InChI=1S/C19H28NO2.ClH/c1-17(15-18-9-5-3-6-10-18)11-14-20(16-19(21)22-2)12-7-4-8-13-20;/h3,5-6,9-11H,4,7-8,12-16H2,1-2H3;1H/q+1;/p-1/b17-11+; |
| InChIKey | XCMZUTXZECGIRB-SJDTYFKWSA-M |
| XLogP | 0.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.89 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|