C16H23N3O — CID 6445862
(3E)-1-(2,6-diethylphenyl)-3-(1-methylpyrrolidin-2-ylidene)urea (PubChem CID 6445862) has the molecular formula C16H23N3O and a molecular weight of 273.38 g/mol. Its IUPAC name is (3E)-1-(2,6-diethylphenyl)-3-(1-methylpyrrolidin-2-ylidene)urea.
| Compound Name | (3E)-1-(2,6-diethylphenyl)-3-(1-methylpyrrolidin-2-ylidene)urea |
|---|---|
| PubChem CID | 6445862 |
| Molecular Formula | C16H23N3O |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | (3E)-1-(2,6-diethylphenyl)-3-(1-methylpyrrolidin-2-ylidene)urea |
| SMILES | CCc1cccc(CC)c1NC(=O)/N=C1\CCCN1C |
| InChI | InChI=1S/C16H23N3O/c1-4-12-8-6-9-13(5-2)15(12)18-16(20)17-14-10-7-11-19(14)3/h6,8-9H,4-5,7,10-11H2,1-3H3,(H,18,20)/b17-14+ |
| InChIKey | MCKILCYWBREFSV-SAPNQHFASA-N |
| XLogP | 3.47 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|