C11H16N2O5S2 — CID 64552219
3-[(cyclopropylsulfonylamino)methyl]-4-methoxybenzenesulfonamide (PubChem CID 64552219) has the molecular formula C11H16N2O5S2 and a molecular weight of 320.39 g/mol. Its IUPAC name is 3-[(cyclopropylsulfonylamino)methyl]-4-methoxybenzenesulfonamide.
| Compound Name | 3-[(cyclopropylsulfonylamino)methyl]-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 64552219 |
| Molecular Formula | C11H16N2O5S2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | 3-[(cyclopropylsulfonylamino)methyl]-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(N)(=O)=O)cc1CNS(=O)(=O)C1CC1 |
| InChI | InChI=1S/C11H16N2O5S2/c1-18-11-5-4-10(19(12,14)15)6-8(11)7-13-20(16,17)9-2-3-9/h4-6,9,13H,2-3,7H2,1H3,(H2,12,14,15) |
| InChIKey | TYTINZDCIRAVQO-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |