C33H44O8 — CID 6455691
2-benzofuran-1,3-dione;[2-(hydroxymethyl)-2-methyl-3-(7-methyloctanoyloxy)propyl] 4-tert-butylbenzoate (PubChem CID 6455691) has the molecular formula C33H44O8 and a molecular weight of 568.71 g/mol. Its IUPAC name is 2-benzofuran-1,3-dione;[2-(hydroxymethyl)-2-methyl-3-(7-methyloctanoyloxy)propyl] 4-tert-butylbenzoate.
| Compound Name | 2-benzofuran-1,3-dione;[2-(hydroxymethyl)-2-methyl-3-(7-methyloctanoyloxy)propyl] 4-tert-butylbenzoate |
|---|---|
| PubChem CID | 6455691 |
| Molecular Formula | C33H44O8 |
| Molecular Weight | 568.71 g/mol |
| Exact Mass | 568.30 |
| IUPAC Name | 2-benzofuran-1,3-dione;[2-(hydroxymethyl)-2-methyl-3-(7-methyloctanoyloxy)propyl] 4-tert-butylbenzoate |
| SMILES | CC(C)CCCCCC(=O)OCC(C)(CO)COC(=O)c1ccc(C(C)(C)C)cc1.O=C1OC(=O)c2ccccc21 |
| InChI | InChI=1S/C25H40O5.C8H4O3/c1-19(2)10-8-7-9-11-22(27)29-17-25(6,16-26)18-30-23(28)20-12-14-21(15-13-20)24(3,4)5;9-7-5-3-1-2-4-6(5)8(10)11-7/h12-15,19,26H,7-11,16-18H2,1-6H3;1-4H |
| InChIKey | LYDHHXNEVSINDT-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.71 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|