C13H16F4N2O — CID 64565327
1-[5-fluoro-2-(3,3,3-trifluoropropoxy)phenyl]piperazine (PubChem CID 64565327) has the molecular formula C13H16F4N2O and a molecular weight of 292.28 g/mol. Its IUPAC name is 1-[5-fluoro-2-(3,3,3-trifluoropropoxy)phenyl]piperazine.
| Compound Name | 1-[5-fluoro-2-(3,3,3-trifluoropropoxy)phenyl]piperazine |
|---|---|
| PubChem CID | 64565327 |
| Molecular Formula | C13H16F4N2O |
| Molecular Weight | 292.28 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 1-[5-fluoro-2-(3,3,3-trifluoropropoxy)phenyl]piperazine |
| SMILES | Fc1ccc(OCCC(F)(F)F)c(N2CCNCC2)c1 |
| InChI | InChI=1S/C13H16F4N2O/c14-10-1-2-12(20-8-3-13(15,16)17)11(9-10)19-6-4-18-5-7-19/h1-2,9,18H,3-8H2 |
| InChIKey | JJYOREOKOGINKV-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.28 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |