C18H12F6N4O4S2 — CID 6483554
2-[[2-carbamoyl-4-[(2,2,2-trifluoroacetyl)amino]phenyl]disulfanyl]-5-[(2,2,2-trifluoroacetyl)amino]benzamide (PubChem CID 6483554) has the molecular formula C18H12F6N4O4S2 and a molecular weight of 526.44 g/mol. Its IUPAC name is 2-[[2-carbamoyl-4-[(2,2,2-trifluoroacetyl)amino]phenyl]disulfanyl]-5-[(2,2,2-trifluoroacetyl)amino]benzamide.
| Compound Name | 2-[[2-carbamoyl-4-[(2,2,2-trifluoroacetyl)amino]phenyl]disulfanyl]-5-[(2,2,2-trifluoroacetyl)amino]benzamide |
|---|---|
| PubChem CID | 6483554 |
| Molecular Formula | C18H12F6N4O4S2 |
| Molecular Weight | 526.44 g/mol |
| Exact Mass | 526.02 |
| IUPAC Name | 2-[[2-carbamoyl-4-[(2,2,2-trifluoroacetyl)amino]phenyl]disulfanyl]-5-[(2,2,2-trifluoroacetyl)amino]benzamide |
| SMILES | NC(=O)c1cc(NC(=O)C(F)(F)F)ccc1SSc1ccc(NC(=O)C(F)(F)F)cc1C(N)=O |
| InChI | InChI=1S/C18H12F6N4O4S2/c19-17(20,21)15(31)27-7-1-3-11(9(5-7)13(25)29)33-34-12-4-2-8(6-10(12)14(26)30)28-16(32)18(22,23)24/h1-6H,(H2,25,29)(H2,26,30)(H,27,31)(H,28,32) |
| InChIKey | TUMSVUSNVUYTJB-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 144.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.44 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|