C12H20BrN3O2S — CID 65004391
3-[[4-(bromomethyl)oxan-4-yl]methylsulfanyl]-4-propyl-1H-1,2,4-triazol-5-one (PubChem CID 65004391) has the molecular formula C12H20BrN3O2S and a molecular weight of 350.28 g/mol. Its IUPAC name is 3-[[4-(bromomethyl)oxan-4-yl]methylsulfanyl]-4-propyl-1H-1,2,4-triazol-5-one.
| Compound Name | 3-[[4-(bromomethyl)oxan-4-yl]methylsulfanyl]-4-propyl-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 65004391 |
| Molecular Formula | C12H20BrN3O2S |
| Molecular Weight | 350.28 g/mol |
| Exact Mass | 349.05 |
| IUPAC Name | 3-[[4-(bromomethyl)oxan-4-yl]methylsulfanyl]-4-propyl-1H-1,2,4-triazol-5-one |
| SMILES | CCCn1c(SCC2(CBr)CCOCC2)n[nH]c1=O |
| InChI | InChI=1S/C12H20BrN3O2S/c1-2-5-16-10(17)14-15-11(16)19-9-12(8-13)3-6-18-7-4-12/h2-9H2,1H3,(H,14,17) |
| InChIKey | VGRDEFJQYOWYCA-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 59.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.28 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|