C14H11Cl2F3N2 — CID 65029357
3-chloro-N-[4-(2-chloroethyl)phenyl]-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 65029357) has the molecular formula C14H11Cl2F3N2 and a molecular weight of 335.16 g/mol. Its IUPAC name is 3-chloro-N-[4-(2-chloroethyl)phenyl]-5-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 3-chloro-N-[4-(2-chloroethyl)phenyl]-5-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 65029357 |
| Molecular Formula | C14H11Cl2F3N2 |
| Molecular Weight | 335.16 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | 3-chloro-N-[4-(2-chloroethyl)phenyl]-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | FC(F)(F)c1cnc(Nc2ccc(CCCl)cc2)c(Cl)c1 |
| InChI | InChI=1S/C14H11Cl2F3N2/c15-6-5-9-1-3-11(4-2-9)21-13-12(16)7-10(8-20-13)14(17,18)19/h1-4,7-8H,5-6H2,(H,20,21) |
| InChIKey | GYEQRYUFKDTYQN-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.16 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|