C7H12ClF2NO2S — CID 65031045
N-(2-chlorocyclohexyl)-1,1-difluoromethanesulfonamide (PubChem CID 65031045) has the molecular formula C7H12ClF2NO2S and a molecular weight of 247.69 g/mol. Its IUPAC name is N-(2-chlorocyclohexyl)-1,1-difluoromethanesulfonamide.
| Compound Name | N-(2-chlorocyclohexyl)-1,1-difluoromethanesulfonamide |
|---|---|
| PubChem CID | 65031045 |
| Molecular Formula | C7H12ClF2NO2S |
| Molecular Weight | 247.69 g/mol |
| Exact Mass | 247.02 |
| IUPAC Name | N-(2-chlorocyclohexyl)-1,1-difluoromethanesulfonamide |
| SMILES | O=S(=O)(NC1CCCCC1Cl)C(F)F |
| InChI | InChI=1S/C7H12ClF2NO2S/c8-5-3-1-2-4-6(5)11-14(12,13)7(9)10/h5-7,11H,1-4H2 |
| InChIKey | MFGABEYAORADIE-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.69 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|