C27H24O4 — CID 6515346
methyl (2E)-2-[(2,4-diphenyl-6,7-dihydro-5H-chromen-8-yl)methylidene]-3-oxobutanoate (PubChem CID 6515346) has the molecular formula C27H24O4 and a molecular weight of 412.49 g/mol. Its IUPAC name is methyl (2E)-2-[(2,4-diphenyl-6,7-dihydro-5H-chromen-8-yl)methylidene]-3-oxobutanoate.
| Compound Name | methyl (2E)-2-[(2,4-diphenyl-6,7-dihydro-5H-chromen-8-yl)methylidene]-3-oxobutanoate |
|---|---|
| PubChem CID | 6515346 |
| Molecular Formula | C27H24O4 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | methyl (2E)-2-[(2,4-diphenyl-6,7-dihydro-5H-chromen-8-yl)methylidene]-3-oxobutanoate |
| SMILES | COC(=O)/C(=C/C1=C2OC(c3ccccc3)=CC(c3ccccc3)=C2CCC1)C(C)=O |
| InChI | InChI=1S/C27H24O4/c1-18(28)23(27(29)30-2)16-21-14-9-15-22-24(19-10-5-3-6-11-19)17-25(31-26(21)22)20-12-7-4-8-13-20/h3-8,10-13,16-17H,9,14-15H2,1-2H3/b23-16+ |
| InChIKey | XPZRRMJKWOFJNV-XQNSMLJCSA-N |
| XLogP | 5.64 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|