C14H17Cl — CID 65174776
2-[(3-chlorocyclopenten-1-yl)methyl]-1,4-dimethylbenzene (PubChem CID 65174776) has the molecular formula C14H17Cl and a molecular weight of 220.74 g/mol. Its IUPAC name is 2-[(3-chlorocyclopenten-1-yl)methyl]-1,4-dimethylbenzene.
| Compound Name | 2-[(3-chlorocyclopenten-1-yl)methyl]-1,4-dimethylbenzene |
|---|---|
| PubChem CID | 65174776 |
| Molecular Formula | C14H17Cl |
| Molecular Weight | 220.74 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 2-[(3-chlorocyclopenten-1-yl)methyl]-1,4-dimethylbenzene |
| SMILES | Cc1ccc(C)c(CC2=CC(Cl)CC2)c1 |
| InChI | InChI=1S/C14H17Cl/c1-10-3-4-11(2)13(7-10)8-12-5-6-14(15)9-12/h3-4,7,9,14H,5-6,8H2,1-2H3 |
| InChIKey | OYHKAYCDWIHGCB-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.74 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|