C14H20ClNO3 — CID 65210732
1-[(5-chloro-2,4-dimethoxyanilino)methyl]cyclopentan-1-ol (PubChem CID 65210732) has the molecular formula C14H20ClNO3 and a molecular weight of 285.77 g/mol. Its IUPAC name is 1-[(5-chloro-2,4-dimethoxyanilino)methyl]cyclopentan-1-ol.
| Compound Name | 1-[(5-chloro-2,4-dimethoxyanilino)methyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 65210732 |
| Molecular Formula | C14H20ClNO3 |
| Molecular Weight | 285.77 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 1-[(5-chloro-2,4-dimethoxyanilino)methyl]cyclopentan-1-ol |
| SMILES | COc1cc(OC)c(NCC2(O)CCCC2)cc1Cl |
| InChI | InChI=1S/C14H20ClNO3/c1-18-12-8-13(19-2)11(7-10(12)15)16-9-14(17)5-3-4-6-14/h7-8,16-17H,3-6,9H2,1-2H3 |
| InChIKey | VNOYRHUGEHHQGQ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.77 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|