C19H25ClS — CID 65237895
5-[chloro-[2,4-di(propan-2-yl)phenyl]methyl]-2,3-dimethylthiophene (PubChem CID 65237895) has the molecular formula C19H25ClS and a molecular weight of 320.93 g/mol. Its IUPAC name is 5-[chloro-[2,4-di(propan-2-yl)phenyl]methyl]-2,3-dimethylthiophene.
| Compound Name | 5-[chloro-[2,4-di(propan-2-yl)phenyl]methyl]-2,3-dimethylthiophene |
|---|---|
| PubChem CID | 65237895 |
| Molecular Formula | C19H25ClS |
| Molecular Weight | 320.93 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | 5-[chloro-[2,4-di(propan-2-yl)phenyl]methyl]-2,3-dimethylthiophene |
| SMILES | Cc1cc(C(Cl)c2ccc(C(C)C)cc2C(C)C)sc1C |
| InChI | InChI=1S/C19H25ClS/c1-11(2)15-7-8-16(17(10-15)12(3)4)19(20)18-9-13(5)14(6)21-18/h7-12,19H,1-6H3 |
| InChIKey | NCZCZCANSHFXCK-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.93 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|