C15H20INO3 — CID 65284317
6-[(4-iodobenzoyl)amino]-4,4-dimethylhexanoic acid (PubChem CID 65284317) has the molecular formula C15H20INO3 and a molecular weight of 389.23 g/mol. Its IUPAC name is 6-[(4-iodobenzoyl)amino]-4,4-dimethylhexanoic acid.
| Compound Name | 6-[(4-iodobenzoyl)amino]-4,4-dimethylhexanoic acid |
|---|---|
| PubChem CID | 65284317 |
| Molecular Formula | C15H20INO3 |
| Molecular Weight | 389.23 g/mol |
| Exact Mass | 389.05 |
| IUPAC Name | 6-[(4-iodobenzoyl)amino]-4,4-dimethylhexanoic acid |
| SMILES | CC(C)(CCNC(=O)c1ccc(I)cc1)CCC(=O)O |
| InChI | InChI=1S/C15H20INO3/c1-15(2,8-7-13(18)19)9-10-17-14(20)11-3-5-12(16)6-4-11/h3-6H,7-10H2,1-2H3,(H,17,20)(H,18,19) |
| InChIKey | BLQOMHXFJQNBQM-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.23 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|