C21H20N2O5 — CID 6533519
methyl (Z)-3-amino-2-[2,5-dioxo-1-(4-phenoxyphenyl)pyrrolidin-3-yl]but-2-enoate (PubChem CID 6533519) has the molecular formula C21H20N2O5 and a molecular weight of 380.40 g/mol. Its IUPAC name is methyl (Z)-3-amino-2-[2,5-dioxo-1-(4-phenoxyphenyl)pyrrolidin-3-yl]but-2-enoate.
| Compound Name | methyl (Z)-3-amino-2-[2,5-dioxo-1-(4-phenoxyphenyl)pyrrolidin-3-yl]but-2-enoate |
|---|---|
| PubChem CID | 6533519 |
| Molecular Formula | C21H20N2O5 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | methyl (Z)-3-amino-2-[2,5-dioxo-1-(4-phenoxyphenyl)pyrrolidin-3-yl]but-2-enoate |
| SMILES | COC(=O)/C(=C(/C)N)C1CC(=O)N(c2ccc(Oc3ccccc3)cc2)C1=O |
| InChI | InChI=1S/C21H20N2O5/c1-13(22)19(21(26)27-2)17-12-18(24)23(20(17)25)14-8-10-16(11-9-14)28-15-6-4-3-5-7-15/h3-11,17H,12,22H2,1-2H3/b19-13- |
| InChIKey | UGVBNKUSTZCZAT-UYRXBGFRSA-N |
| XLogP | 2.76 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|