C15H20BrNO — CID 65472274
4-[2-(bromomethyl)pentoxy]-3,5-dimethylbenzonitrile (PubChem CID 65472274) has the molecular formula C15H20BrNO and a molecular weight of 310.24 g/mol. Its IUPAC name is 4-[2-(bromomethyl)pentoxy]-3,5-dimethylbenzonitrile.
| Compound Name | 4-[2-(bromomethyl)pentoxy]-3,5-dimethylbenzonitrile |
|---|---|
| PubChem CID | 65472274 |
| Molecular Formula | C15H20BrNO |
| Molecular Weight | 310.24 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 4-[2-(bromomethyl)pentoxy]-3,5-dimethylbenzonitrile |
| SMILES | CCCC(CBr)COc1c(C)cc(C#N)cc1C |
| InChI | InChI=1S/C15H20BrNO/c1-4-5-13(8-16)10-18-15-11(2)6-14(9-17)7-12(15)3/h6-7,13H,4-5,8,10H2,1-3H3 |
| InChIKey | MKWSHUQEXLXREM-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.24 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|