C18H33N2O2+ — CID 6564403
[(1R,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] 2-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)acetate (PubChem CID 6564403) has the molecular formula C18H33N2O2+ and a molecular weight of 309.47 g/mol. Its IUPAC name is [(1R,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] 2-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)acetate.
| Compound Name | [(1R,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] 2-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)acetate |
|---|---|
| PubChem CID | 6564403 |
| Molecular Formula | C18H33N2O2+ |
| Molecular Weight | 309.47 g/mol |
| Exact Mass | 309.25 |
| IUPAC Name | [(1R,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] 2-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)acetate |
| SMILES | CC(C)C1CC[C@H](C)C[C@H]1OC(=O)C[N+]12CCN(CC1)CC2 |
| InChI | InChI=1S/C18H33N2O2/c1-14(2)16-5-4-15(3)12-17(16)22-18(21)13-20-9-6-19(7-10-20)8-11-20/h14-17H,4-13H2,1-3H3/q+1/t15-,16?,17+/m0/s1 |
| InChIKey | ZJMONDWELKSROR-RPCGPGEBSA-N |
| XLogP | 2.14 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.47 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|