C23H18ClF3N5OS+ — CID 6583938
[amino-[(6-chloro-4-phenylquinazolin-2-yl)amino]methylidene]-[(2S)-1,1,1-trifluoro-4-oxo-4-thiophen-2-ylbutan-2-yl]azanium (PubChem CID 6583938) has the molecular formula C23H18ClF3N5OS+ and a molecular weight of 504.95 g/mol. Its IUPAC name is [amino-[(6-chloro-4-phenylquinazolin-2-yl)amino]methylidene]-[(2S)-1,1,1-trifluoro-4-oxo-4-thiophen-2-ylbutan-2-yl]azanium.
| Compound Name | [amino-[(6-chloro-4-phenylquinazolin-2-yl)amino]methylidene]-[(2S)-1,1,1-trifluoro-4-oxo-4-thiophen-2-ylbutan-2-yl]azanium |
|---|---|
| PubChem CID | 6583938 |
| Molecular Formula | C23H18ClF3N5OS+ |
| Molecular Weight | 504.95 g/mol |
| Exact Mass | 504.09 |
| IUPAC Name | [amino-[(6-chloro-4-phenylquinazolin-2-yl)amino]methylidene]-[(2S)-1,1,1-trifluoro-4-oxo-4-thiophen-2-ylbutan-2-yl]azanium |
| SMILES | N/C(Nc1nc(-c2ccccc2)c2cc(Cl)ccc2n1)=[NH+]\[C@@H](CC(=O)c1cccs1)C(F)(F)F |
| InChI | InChI=1S/C23H17ClF3N5OS/c24-14-8-9-16-15(11-14)20(13-5-2-1-3-6-13)31-22(29-16)32-21(28)30-19(23(25,26)27)12-17(33)18-7-4-10-34-18/h1-11,19H,12H2,(H3,28,29,30,31,32)/p+1/t19-/m0/s1 |
| InChIKey | LDCQZGZBWGSXQJ-IBGZPJMESA-O |
| XLogP | 4.02 |
| TPSA | 94.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.95 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|