C12H12N2O3 — CID 659648
6-methoxy-4-oxido-2,3-dihydro-1H-cyclopenta[b]quinoxalin-9-ium 9-oxide (PubChem CID 659648) has the molecular formula C12H12N2O3 and a molecular weight of 232.24 g/mol. Its IUPAC name is 6-methoxy-4-oxido-2,3-dihydro-1H-cyclopenta[b]quinoxalin-9-ium 9-oxide.
| Compound Name | 6-methoxy-4-oxido-2,3-dihydro-1H-cyclopenta[b]quinoxalin-9-ium 9-oxide |
|---|---|
| PubChem CID | 659648 |
| Molecular Formula | C12H12N2O3 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 6-methoxy-4-oxido-2,3-dihydro-1H-cyclopenta[b]quinoxalin-9-ium 9-oxide |
| SMILES | COc1ccc2c(c1)n([O-])c1c([n+]2=O)CCC1 |
| InChI | InChI=1S/C12H12N2O3/c1-17-8-5-6-11-12(7-8)14(16)10-4-2-3-9(10)13(11)15/h5-7H,2-4H2,1H3 |
| InChIKey | PJMQERYIKCJUIW-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 60.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|