C13H11ClN4O2S — CID 66014520
2-(5-chloro-4-nitro-3-propylpyrazol-1-yl)-1,3-benzothiazole (PubChem CID 66014520) has the molecular formula C13H11ClN4O2S and a molecular weight of 322.78 g/mol. Its IUPAC name is 2-(5-chloro-4-nitro-3-propylpyrazol-1-yl)-1,3-benzothiazole.
| Compound Name | 2-(5-chloro-4-nitro-3-propylpyrazol-1-yl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 66014520 |
| Molecular Formula | C13H11ClN4O2S |
| Molecular Weight | 322.78 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | 2-(5-chloro-4-nitro-3-propylpyrazol-1-yl)-1,3-benzothiazole |
| SMILES | CCCc1nn(-c2nc3ccccc3s2)c(Cl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H11ClN4O2S/c1-2-5-9-11(18(19)20)12(14)17(16-9)13-15-8-6-3-4-7-10(8)21-13/h3-4,6-7H,2,5H2,1H3 |
| InChIKey | QSBROTHFONNOJP-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 73.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.78 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|