C10H6N4O2S — CID 49429533
2-(3-nitropyrazol-1-yl)-1,3-benzothiazole (PubChem CID 49429533) has the molecular formula C10H6N4O2S and a molecular weight of 246.25 g/mol. Its IUPAC name is 2-(3-nitropyrazol-1-yl)-1,3-benzothiazole.
| Compound Name | 2-(3-nitropyrazol-1-yl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 49429533 |
| Molecular Formula | C10H6N4O2S |
| Molecular Weight | 246.25 g/mol |
| Exact Mass | 246.02 |
| IUPAC Name | 2-(3-nitropyrazol-1-yl)-1,3-benzothiazole |
| SMILES | O=[N+]([O-])c1ccn(-c2nc3ccccc3s2)n1 |
| InChI | InChI=1S/C10H6N4O2S/c15-14(16)9-5-6-13(12-9)10-11-7-3-1-2-4-8(7)17-10/h1-6H |
| InChIKey | UNXOVSZETHQRGT-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 73.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.25 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|