C13H13F2N3O3 — CID 66067197
N-(2,4-difluorophenyl)-2-ethyl-3,5-dioxopiperazine-1-carboxamide (PubChem CID 66067197) has the molecular formula C13H13F2N3O3 and a molecular weight of 297.26 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-2-ethyl-3,5-dioxopiperazine-1-carboxamide.
| Compound Name | N-(2,4-difluorophenyl)-2-ethyl-3,5-dioxopiperazine-1-carboxamide |
|---|---|
| PubChem CID | 66067197 |
| Molecular Formula | C13H13F2N3O3 |
| Molecular Weight | 297.26 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | N-(2,4-difluorophenyl)-2-ethyl-3,5-dioxopiperazine-1-carboxamide |
| SMILES | CCC1C(=O)NC(=O)CN1C(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C13H13F2N3O3/c1-2-10-12(20)17-11(19)6-18(10)13(21)16-9-4-3-7(14)5-8(9)15/h3-5,10H,2,6H2,1H3,(H,16,21)(H,17,19,20) |
| InChIKey | VJJSAWGGKJFLKB-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.26 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|