C12H17NO3S — CID 66115186
3-[(6-amino-2,3-dihydro-1,4-benzodioxin-7-yl)methylsulfanyl]propan-1-ol (PubChem CID 66115186) has the molecular formula C12H17NO3S and a molecular weight of 255.34 g/mol. Its IUPAC name is 3-[(6-amino-2,3-dihydro-1,4-benzodioxin-7-yl)methylsulfanyl]propan-1-ol.
| Compound Name | 3-[(6-amino-2,3-dihydro-1,4-benzodioxin-7-yl)methylsulfanyl]propan-1-ol |
|---|---|
| PubChem CID | 66115186 |
| Molecular Formula | C12H17NO3S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 3-[(6-amino-2,3-dihydro-1,4-benzodioxin-7-yl)methylsulfanyl]propan-1-ol |
| SMILES | Nc1cc2c(cc1CSCCCO)OCCO2 |
| InChI | InChI=1S/C12H17NO3S/c13-10-7-12-11(15-3-4-16-12)6-9(10)8-17-5-1-2-14/h6-7,14H,1-5,8,13H2 |
| InChIKey | LMQNVNPILABLMC-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|