C25H17FN6O5 — CID 6616074
ethyl 5-[[13-(4-fluorophenyl)-4-nitro-8,10,12,15,16-pentazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2(7),3,5,9,11,13-heptaen-8-yl]methyl]furan-2-carboxylate (PubChem CID 6616074) has the molecular formula C25H17FN6O5 and a molecular weight of 500.45 g/mol. Its IUPAC name is ethyl 5-[[13-(4-fluorophenyl)-4-nitro-8,10,12,15,16-pentazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2(7),3,5,9,11,13-heptaen-8-yl]methyl]furan-2-carboxylate.
| Compound Name | ethyl 5-[[13-(4-fluorophenyl)-4-nitro-8,10,12,15,16-pentazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2(7),3,5,9,11,13-heptaen-8-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 6616074 |
| Molecular Formula | C25H17FN6O5 |
| Molecular Weight | 500.45 g/mol |
| Exact Mass | 500.12 |
| IUPAC Name | ethyl 5-[[13-(4-fluorophenyl)-4-nitro-8,10,12,15,16-pentazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2(7),3,5,9,11,13-heptaen-8-yl]methyl]furan-2-carboxylate |
| SMILES | CCOC(=O)c1ccc(Cn2c3ccc([N+](=O)[O-])cc3c3nn4cc(-c5ccc(F)cc5)nc4nc32)o1 |
| InChI | InChI=1S/C25H17FN6O5/c1-2-36-24(33)21-10-8-17(37-21)12-30-20-9-7-16(32(34)35)11-18(20)22-23(30)28-25-27-19(13-31(25)29-22)14-3-5-15(26)6-4-14/h3-11,13H,2,12H2,1H3 |
| InChIKey | QNUQQVSIRNSHIL-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 130.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.45 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|