C11H17NO3S — CID 66234442
3-(furan-2-yl)-2,5-dimethyl-1,4-thiazepane 1,1-dioxide (PubChem CID 66234442) has the molecular formula C11H17NO3S and a molecular weight of 243.33 g/mol. Its IUPAC name is 3-(furan-2-yl)-2,5-dimethyl-1,4-thiazepane 1,1-dioxide.
| Compound Name | 3-(furan-2-yl)-2,5-dimethyl-1,4-thiazepane 1,1-dioxide |
|---|---|
| PubChem CID | 66234442 |
| Molecular Formula | C11H17NO3S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | 3-(furan-2-yl)-2,5-dimethyl-1,4-thiazepane 1,1-dioxide |
| SMILES | CC1CCS(=O)(=O)C(C)C(c2ccco2)N1 |
| InChI | InChI=1S/C11H17NO3S/c1-8-5-7-16(13,14)9(2)11(12-8)10-4-3-6-15-10/h3-4,6,8-9,11-12H,5,7H2,1-2H3 |
| InChIKey | XOPHPOOLXRSJBO-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |