C8H9ClN4O — CID 66273038
2-(3-chloropropyl)-[1,2,4]triazolo[4,3-a]pyrazin-3-one (PubChem CID 66273038) has the molecular formula C8H9ClN4O and a molecular weight of 212.64 g/mol. Its IUPAC name is 2-(3-chloropropyl)-[1,2,4]triazolo[4,3-a]pyrazin-3-one.
| Compound Name | 2-(3-chloropropyl)-[1,2,4]triazolo[4,3-a]pyrazin-3-one |
|---|---|
| PubChem CID | 66273038 |
| Molecular Formula | C8H9ClN4O |
| Molecular Weight | 212.64 g/mol |
| Exact Mass | 212.05 |
| IUPAC Name | 2-(3-chloropropyl)-[1,2,4]triazolo[4,3-a]pyrazin-3-one |
| SMILES | O=c1n(CCCCl)nc2cnccn12 |
| InChI | InChI=1S/C8H9ClN4O/c9-2-1-4-13-8(14)12-5-3-10-6-7(12)11-13/h3,5-6H,1-2,4H2 |
| InChIKey | NPLQDLCIVZFITH-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 52.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.64 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|