C14H16N2S2 — CID 66290520
4-(azetidin-3-ylmethylsulfanylmethyl)-2-phenyl-1,3-thiazole (PubChem CID 66290520) has the molecular formula C14H16N2S2 and a molecular weight of 276.43 g/mol. Its IUPAC name is 4-(azetidin-3-ylmethylsulfanylmethyl)-2-phenyl-1,3-thiazole.
| Compound Name | 4-(azetidin-3-ylmethylsulfanylmethyl)-2-phenyl-1,3-thiazole |
|---|---|
| PubChem CID | 66290520 |
| Molecular Formula | C14H16N2S2 |
| Molecular Weight | 276.43 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | 4-(azetidin-3-ylmethylsulfanylmethyl)-2-phenyl-1,3-thiazole |
| SMILES | c1ccc(-c2nc(CSCC3CNC3)cs2)cc1 |
| InChI | InChI=1S/C14H16N2S2/c1-2-4-12(5-3-1)14-16-13(10-18-14)9-17-8-11-6-15-7-11/h1-5,10-11,15H,6-9H2 |
| InChIKey | NOADMNOJBOMKIV-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.43 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |