C9H11F3N2O3 — CID 66328173
5-ethyl-1-[2-(trifluoromethoxy)ethyl]pyrimidine-2,4-dione (PubChem CID 66328173) has the molecular formula C9H11F3N2O3 and a molecular weight of 252.19 g/mol. Its IUPAC name is 5-ethyl-1-[2-(trifluoromethoxy)ethyl]pyrimidine-2,4-dione.
| Compound Name | 5-ethyl-1-[2-(trifluoromethoxy)ethyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 66328173 |
| Molecular Formula | C9H11F3N2O3 |
| Molecular Weight | 252.19 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 5-ethyl-1-[2-(trifluoromethoxy)ethyl]pyrimidine-2,4-dione |
| SMILES | CCc1cn(CCOC(F)(F)F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C9H11F3N2O3/c1-2-6-5-14(8(16)13-7(6)15)3-4-17-9(10,11)12/h5H,2-4H2,1H3,(H,13,15,16) |
| InChIKey | HILRNVIQXPJTMA-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.19 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |